Difference between revisions of "Guanine26-in-tRNA"

Revision as of 15:24, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite MG-PROTOPORPHYRIN ==
+== Metabolite CPD-17866 ==
+* common-name:
+** s-sulfinatoglutathione
 * smiles:
-** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)[o-])c(n56)=c7))))8))))
+** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
-* common-name:
+* inchi-key:
-** mg-protoporphyrin
+** qubutnszzfichl-wdskdsinsa-l
 * molecular-weight:
-** 582.94
+** 369.364
 == Reaction(s) known to consume the compound ==
-* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN1F-20]]
+* [[FESGSHTHIO-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=mg-protoporphyrin}}
+{{#set: common-name=s-sulfinatoglutathione}}
-{{#set: molecular-weight=582.94}}
+{{#set: inchi-key=inchikey=qubutnszzfichl-wdskdsinsa-l}}
+{{#set: molecular-weight=369.364}}