Difference between revisions of "Guanine34-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9869 == * common-name: ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
(Created page with "Category:metabolite == Metabolite CPD-714 == * common-name: ** cathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9869 ==
+
== Metabolite CPD-714 ==
 
* common-name:
 
* common-name:
** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
+
** cathasterone
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** lioknoijmjkvcg-rdsvhmiisa-n
+
** jsvpgvhceqdjcz-vgehdtswsa-n
 
* molecular-weight:
 
* molecular-weight:
** 821.32
+
** 432.685
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9235]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-715]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}}
+
{{#set: common-name=cathasterone}}
{{#set: inchi-key=inchikey=lioknoijmjkvcg-rdsvhmiisa-n}}
+
{{#set: inchi-key=inchikey=jsvpgvhceqdjcz-vgehdtswsa-n}}
{{#set: molecular-weight=821.32}}
+
{{#set: molecular-weight=432.685}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-714

  • common-name:
    • cathasterone
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • jsvpgvhceqdjcz-vgehdtswsa-n
  • molecular-weight:
    • 432.685

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality