Difference between revisions of "Guanine9-in-tRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9899 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
(Created page with "Category:metabolite == Metabolite L-LACTATE == * common-name: ** (s)-lactate * smiles: ** cc(c([o-])=o)o * inchi-key: ** jvtaaekczfnvcj-reohclbhsa-m * molecular-weight: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9899 ==
+
== Metabolite L-LACTATE ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate
+
** (s)-lactate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
+
** cc(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** dzwhypvptjpqqx-mycgwmctsa-m
+
** jvtaaekczfnvcj-reohclbhsa-m
 
* molecular-weight:
 
* molecular-weight:
** 712.086
+
** 89.071
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[L-LACTATE-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9280]]
+
* [[L-LACTATE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-octaprenylbenzoate}}
+
{{#set: common-name=(s)-lactate}}
{{#set: inchi-key=inchikey=dzwhypvptjpqqx-mycgwmctsa-m}}
+
{{#set: inchi-key=inchikey=jvtaaekczfnvcj-reohclbhsa-m}}
{{#set: molecular-weight=712.086}}
+
{{#set: molecular-weight=89.071}}

Revision as of 15:31, 5 January 2021

Metabolite L-LACTATE

  • common-name:
    • (s)-lactate
  • smiles:
    • cc(c([o-])=o)o
  • inchi-key:
    • jvtaaekczfnvcj-reohclbhsa-m
  • molecular-weight:
    • 89.071

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality