Difference between revisions of "Guanosine-34-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...") |
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HIS == |
* common-name: | * common-name: | ||
− | ** | + | ** l-histidine |
+ | * smiles: | ||
+ | ** c1(nc=nc=1cc(c(=o)[o-])[n+]) | ||
+ | * inchi-key: | ||
+ | ** hndvdqjcigzpno-yfkpbyrvsa-n | ||
+ | * molecular-weight: | ||
+ | ** 155.156 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HISTIDINE--TRNA-LIGASE-RXN]] | ||
+ | * [[HISTIDINE-AMMONIA-LYASE-RXN]] | ||
+ | * [[HISTIDINE-DECARBOXYLASE-RXN]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HISTALDEHYD-RXN]] |
+ | * [[RXN-8001]] | ||
+ | * [[RXN0-6978]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-histidine}} |
+ | {{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}} | ||
+ | {{#set: molecular-weight=155.156}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite HIS
- common-name:
- l-histidine
- smiles:
- c1(nc=nc=1cc(c(=o)[o-])[n+])
- inchi-key:
- hndvdqjcigzpno-yfkpbyrvsa-n
- molecular-weight:
- 155.156