Difference between revisions of "Guanosine-34-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...") |
(Created page with "Category:metabolite == Metabolite guanosine-34-tRNAs == * common-name: ** a guanosine34 in trna == Reaction(s) known to consume the compound == * RXN-11868 == Reaction...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite guanosine-34-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a guanosine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11868]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a guanosine34 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite guanosine-34-tRNAs
- common-name:
- a guanosine34 in trna
