Difference between revisions of "Guanosine-34-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...") |
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15280 == |
* common-name: | * common-name: | ||
− | ** | + | ** hercynine |
+ | * smiles: | ||
+ | ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** gppytcrvkhuljh-qmmmgpobsa-n | ||
+ | * molecular-weight: | ||
+ | ** 197.236 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14430]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hercynine}} |
+ | {{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}} | ||
+ | {{#set: molecular-weight=197.236}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-15280
- common-name:
- hercynine
- smiles:
- c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
- inchi-key:
- gppytcrvkhuljh-qmmmgpobsa-n
- molecular-weight:
- 197.236