Difference between revisions of "Guanosine-34-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19787 == * transcription-direction: ** positive * right-end-position: ** 469261 * left-end-position: ** 466508 * centisome-position: ** 73.95908...") |
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite LIPOYL-AMP == |
| − | * | + | * common-name: |
| − | ** | + | ** lipoyl-adenylate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** qwegocjrzoksoe-aduakinbsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 534.518 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-13039]] | |
| − | == Reaction(s) | + | * [[RXN-8655]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-8654]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=lipoyl-adenylate}} | |
| − | + | {{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}} | |
| − | + | {{#set: molecular-weight=534.518}} | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite LIPOYL-AMP
- common-name:
- lipoyl-adenylate
- smiles:
- c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
- inchi-key:
- qwegocjrzoksoe-aduakinbsa-m
- molecular-weight:
- 534.518
