Difference between revisions of "HCN"

Revision as of 13:10, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19153 ==
+== Metabolite THR ==
 * common-name:
-** 3-oxo-(5z)-dodecenoyl-coa
+** l-threonine
 * smiles:
-** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(o)c([n+])c(=o)[o-]
 * inchi-key:
-** vklhslowdwgvgp-cggpsvllsa-j
+** ayfvyjqapqtccc-gbxijsldsa-n
 * molecular-weight:
-** 957.775
+** 119.12
 == Reaction(s) known to consume the compound ==
-* [[RXN-17799]]
+* [[RXN-14249]]
+* [[RXN-14569]]
+* [[RXN-15122]]
+* [[THREDEHYD-RXN]]
+* [[THREODEHYD-RXN]]
+* [[THREONINE--TRNA-LIGASE-RXN]]
+* [[THREONINE-ALDOLASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17798]]
+* [[RXN-14569]]
+* [[RXN-15122]]
+* [[RXN0-6980]]
+* [[THRESYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxo-(5z)-dodecenoyl-coa}}
+{{#set: common-name=l-threonine}}
-{{#set: inchi-key=inchikey=vklhslowdwgvgp-cggpsvllsa-j}}
+{{#set: inchi-key=inchikey=ayfvyjqapqtccc-gbxijsldsa-n}}
-{{#set: molecular-weight=957.775}}
+{{#set: molecular-weight=119.12}}