Difference between revisions of "HEME-BIOSYNTHESIS-II"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(...")
(Created page with "Category:pathway == Pathway PWY-3982 == * taxonomic-range: ** tax-2157 ** tax-300275 ** tax-2 ** tax-33090 ** tax-40674 * common-name: ** uracil degradation i (reductive)...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
+
== Pathway PWY-3982 ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-300275
 +
** tax-2
 +
** tax-33090
 +
** tax-40674
 
* common-name:
 
* common-name:
−
** crotonyl-coa
+
** uracil degradation i (reductive)
−
* smiles:
+
== Reaction(s) found ==
−
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
+
* [[BETA-UREIDOPROPIONASE-RXN]]
−
* inchi-key:
+
== Reaction(s) not found ==
−
** kfwwcmjsysspsk-bogfjhsmsa-j
+
* [NoneDIHYDROPYRIMIDINASE-RXN DIHYDROPYRIMIDINASE-RXN]
−
* molecular-weight:
+
* [None1.3.1.2-RXN 1.3.1.2-RXN]
−
** 831.577
+
{{#set: taxonomic-range=tax-2|tax-40674|tax-33090|tax-300275|tax-2157}}
−
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=uracil degradation i (reductive)}}
−
* [[ACOAD1f]]
+
{{#set: nb reaction found=1}}
−
* [[ACOAR1h]]
+
{{#set: completion rate=0.33}}
−
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
{{#set: nb total reaction=3}}
−
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 
−
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
−
* [[HBCHL]]
 
−
* [[HBCHLm]]
 
−
* [[RXN-11667]]
 
−
* [[RXN-12558]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[ACOA40OR]]
 
−
* [[ACOAD1f]]
 
−
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 
−
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
−
* [[HBCHL]]
 
−
* [[HBCHLm]]
 
−
* [[RXN-11667]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=crotonyl-coa}}
 
−
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
 
−
{{#set: molecular-weight=831.577}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-3982

  • taxonomic-range:
    • tax-2157
    • tax-300275
    • tax-2
    • tax-33090
    • tax-40674
  • common-name:
    • uracil degradation i (reductive)

Reaction(s) found

Reaction(s) not found

  • [NoneDIHYDROPYRIMIDINASE-RXN DIHYDROPYRIMIDINASE-RXN]
  • [None1.3.1.2-RXN 1.3.1.2-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HEME-BIOSYNTHESIS-II&oldid=40197"