Difference between revisions of "HEME C"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GMP == * common-name: ** gmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** rqfcjasxjcidsx-...") |
(Created page with "Category:metabolite == Metabolite HEME_C == * common-name: ** heme c == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYNTHASE-RXN == Reaction(s) kno...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HEME_C == |
* common-name: | * common-name: | ||
| − | ** | + | ** heme c |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HOLOCYTOCHROME-C-SYNTHASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HOLOCYTOCHROME-C-SYNTHASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=heme c}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite HEME_C
- common-name:
- heme c
