Difference between revisions of "HEME C"

Revision as of 13:11, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15678 ==
+== Metabolite GMP ==
 * common-name:
-** 4-trans-3-oxo-undecenoyl-coa
+** gmp
 * smiles:
-** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 * inchi-key:
-** xbfqfvlnmjddng-dupkwvsksa-j
+** rqfcjasxjcidsx-uuokfmhzsa-l
 * molecular-weight:
-** 943.749
+** 361.207
 == Reaction(s) known to consume the compound ==
-* [[RXN-14793]]
+* [[AGPT]]
+* [[GMP-REDUCT-RXN]]
+* [[GUANPRIBOSYLTRAN-RXN]]
+* [[GUANYL-KIN-RXN]]
+* [[RXN-7609]]
 == Reaction(s) known to produce the compound ==
+* [[3.6.1.17-RXN]]
+* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
+* [[GMP-SYN-GLUT-RXN]]
+* [[GMP-SYN-NH3-RXN]]
+* [[GUANOSINE-DIPHOSPHATASE-RXN]]
+* [[GUANPRIBOSYLTRAN-RXN]]
+* [[NTDP]]
+* [[RXN-14140]]
+* [[RXN-14201]]
+* [[RXN-15713]]
+* [[RXN-17923]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
+{{#set: common-name=gmp}}
-{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
+{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
-{{#set: molecular-weight=943.749}}
+{{#set: molecular-weight=361.207}}