Difference between revisions of "HEPARIN-GLUCOSAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * smiles: ** c1(n=cc(c(=o)n)=cc=1) * inchi-key: ** dfpaksucgfbddf-uhfffaoysa-n * molecular-...") |
(Created page with "Category:metabolite == Metabolite CPD-18733 == * common-name: ** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-18733 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c1(c=cc=cc=1[n+](=c(c)c(=o)2)[o-])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rnxnmmdmlfjckp-yefhwucqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 395.541 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17334]] |
| − | * [[ | + | * [[RXN-17335]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rnxnmmdmlfjckp-yefhwucqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=395.541}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-18733
- common-name:
- 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc2(o)(c1(c=cc=cc=1[n+](=c(c)c(=o)2)[o-]))
- inchi-key:
- rnxnmmdmlfjckp-yefhwucqsa-n
- molecular-weight:
- 395.541
