|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6622 RXN-6622] == | + | == Metabolite CPD-18733 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** cytosolic dipeptidase | + | ** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.4.13.18 ec-3.4.13.18]
| + | ** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c1(c=cc=cc=1[n+](=c(c)c(=o)2)[o-])) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[CYS-GLY]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CYS]][c] '''+''' 1 [[GLY]][c]
| + | ** rnxnmmdmlfjckp-yefhwucqsa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ11013]]
| + | ** 395.541 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ21022]] | + | * [[RXN-17334]] |
| − | ** Category: [[orthology]]
| + | * [[RXN-17335]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: common-name=4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=rnxnmmdmlfjckp-yefhwucqsa-n}} |
| − | * Gene: [[SJ00234]]
| + | {{#set: molecular-weight=395.541}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ21020]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ21032]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a [http://metacyc.org/META/NEW-IMAGE?object=PWY-7559 PWY-7559]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041]
| |
| − | ** '''5''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28784 28784]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00899 R00899]
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: common-name=cytosolic dipeptidase}}
| |
| − | {{#set: ec-number=ec-3.4.13.18}}
| |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
