Difference between revisions of "HEPARIN-GLUCOSAMINE-3-O-SULFATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...")
(Created page with "Category:metabolite == Metabolite HEPARIN-GLUCOSAMINE-3-O-SULFATE == * common-name: ** a [heparan sulfate]-α-d-glucosamine 3-sulfate == Reaction(s) known to consume...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11412 ==
+
== Metabolite HEPARIN-GLUCOSAMINE-3-O-SULFATE ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ester glucuronide
+
** a [heparan sulfate]-α-d-glucosamine 3-sulfate
* smiles:
 
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
 
* inchi-key:
 
** fpejnmnxcsitjo-kfyubchvsa-m
 
* molecular-weight:
 
** 797.054
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10618]]
+
* [[2.8.2.30-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ester glucuronide}}
+
{{#set: common-name=a [heparan sulfate]-α-d-glucosamine 3-sulfate}}
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
 
{{#set: molecular-weight=797.054}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite HEPARIN-GLUCOSAMINE-3-O-SULFATE

  • common-name:
    • a [heparan sulfate]-α-d-glucosamine 3-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [heparan sulfate]-α-d-glucosamine 3-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.