Difference between revisions of "HEXANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19854 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * CELLULOSE-SYNTHASE-UDP-F...") |
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite HEXANOYL-COA == |
− | == | + | * common-name: |
− | + | ** hexanoyl-coa | |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | * | + | ** oexfmsfodmqepe-hdrqghtbsa-j |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 861.647 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | {{#set: | + | * [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]] |
− | {{#set: | + | * [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]] |
− | {{#set: | + | * [[RXN-14277]] |
+ | * [[RXN-14278]] | ||
+ | * [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12559]] | ||
+ | * [[RXN-14277]] | ||
+ | * [[RXN-14278]] | ||
+ | * [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=hexanoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}} | ||
+ | {{#set: molecular-weight=861.647}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite HEXANOYL-COA
- common-name:
- hexanoyl-coa
- smiles:
- cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- oexfmsfodmqepe-hdrqghtbsa-j
- molecular-weight:
- 861.647
Reaction(s) known to consume the compound
- 3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.
- ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.
- RXN-14277
- RXN-14278
- [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]