Difference between revisions of "HEXANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19809 == * transcription-direction: ** positive * right-end-position: ** 147186 * left-end-position: ** 138135 * centisome-position: ** 62.824905...")
 
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19809 ==
+
== Metabolite HEXANOYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** hexanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 147186
+
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 138135
+
** oexfmsfodmqepe-hdrqghtbsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 62.824905   
+
** 861.647
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
−
== Reaction(s) associated ==
+
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-14277]]
−
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-14278]]
−
** Category: [[annotation]]
+
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+
* [[RXN-12559]]
−
** Category: [[annotation]]
+
* [[RXN-14277]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14278]]
−
* [[ALANINE-AMINOTRANSFERASE-RXN]]
+
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=hexanoyl-coa}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=861.647}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13698]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[GLYSYN-ALA-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ALANINE-SYN2-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ALANINE-DEG3-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ALACAT2-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7117]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7115]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-7383]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-181]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=147186}}
 
−
{{#set: left-end-position=138135}}
 
−
{{#set: centisome-position=62.824905    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=8}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite HEXANOYL-COA

  • common-name:
    • hexanoyl-coa
  • smiles:
    • cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oexfmsfodmqepe-hdrqghtbsa-j
  • molecular-weight:
    • 861.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HEXANOYL-COA&oldid=136972"