Difference between revisions of "HG+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17375 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol * smiles: ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccc...")
(Created page with "Category:metabolite == Metabolite HG+2 == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffaoysa-n * molecular-weight: ** 200.59 == Reaction(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17375 ==
+
== Metabolite HG+2 ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
+
** hg2+
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
+
** [hg++]
 
* inchi-key:
 
* inchi-key:
** rcalbbvhqnuwno-osfdyrcisa-n
+
** bqpiggfysbelgy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 650.978
+
** 200.59
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MERCURY-II-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16121]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}}
+
{{#set: common-name=hg2+}}
{{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}}
+
{{#set: inchi-key=inchikey=bqpiggfysbelgy-uhfffaoysa-n}}
{{#set: molecular-weight=650.978}}
+
{{#set: molecular-weight=200.59}}

Latest revision as of 11:12, 18 March 2021

Metabolite HG+2

  • common-name:
    • hg2+
  • smiles:
    • [hg++]
  • inchi-key:
    • bqpiggfysbelgy-uhfffaoysa-n
  • molecular-weight:
    • 200.59

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality