Difference between revisions of "HG+2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) * inc...") |
(Created page with "Category:metabolite == Metabolite Receptor-proteins == * common-name: ** a receptor protein == Reaction(s) known to consume the compound == * 2.7.11.30-RXN == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Receptor-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a receptor protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.11.30-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.11.30-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a receptor protein}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite Receptor-proteins
- common-name:
- a receptor protein
