Difference between revisions of "HIF-Alpha"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,3)-bisphosphate * smiles: ** c1(o)(c(o)c(op([o-])([o-])=o)c(o)c(op(...")
(Created page with "Category:metabolite == Metabolite MALTOSE == * common-name: ** maltose == Reaction(s) known to consume the compound == * RXN-15910 == Reaction(s) known to produce the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE ==
+
== Metabolite MALTOSE ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3)-bisphosphate
+
** maltose
* smiles:
 
** c1(o)(c(o)c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
** puvhmwjjtitugo-ficorbcrsa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15910]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10959]]
+
* [[3.2.1.1-RXN]]
 +
* [[RXN0-5183]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3)-bisphosphate}}
+
{{#set: common-name=maltose}}
{{#set: inchi-key=inchikey=puvhmwjjtitugo-ficorbcrsa-j}}
 
{{#set: molecular-weight=336.085}}
 

Revision as of 18:58, 14 January 2021

Metabolite MALTOSE

  • common-name:
    • maltose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality