Difference between revisions of "HIF-Alpha"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2352 ==
+
== Metabolite CPD-11404 ==
 
* common-name:
 
* common-name:
** a trna precursor with a 5' extension and a short 3' extension
+
** 3,3',5-triiodothyroacetate
 +
* smiles:
 +
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
 +
* inchi-key:
 +
** uowzuvnaguaeqc-uhfffaoysa-m
 +
* molecular-weight:
 +
** 620.928
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.26.5-RXN]]
+
* [[RXN-10618]]
 +
* [[RXN-10619]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6479]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trna precursor with a 5' extension and a short 3' extension}}
+
{{#set: common-name=3,3',5-triiodothyroacetate}}
 +
{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
 +
{{#set: molecular-weight=620.928}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-11404

  • common-name:
    • 3,3',5-triiodothyroacetate
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
  • inchi-key:
    • uowzuvnaguaeqc-uhfffaoysa-m
  • molecular-weight:
    • 620.928

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality