Difference between revisions of "HIS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06201 == * transcription-direction: ** negative * right-end-position: ** 152661 * left-end-position: ** 139202 * centisome-position: ** 29.004044...")
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06201 ==
+
== Metabolite HIS ==
* transcription-direction:
+
* common-name:
** negative
+
** l-histidine
* right-end-position:
+
* smiles:
** 152661
+
** c1(nc=nc=1cc(c(=o)[o-])[n+])
* left-end-position:
+
* inchi-key:
** 139202
+
** hndvdqjcigzpno-yfkpbyrvsa-n
* centisome-position:
+
* molecular-weight:
** 29.004044   
+
** 155.156
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
== Reaction(s) associated ==
+
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
* [[PROTEIN-KINASE-RXN]]
+
* [[HISTIDINE-DECARBOXYLASE-RXN]]
** Category: [[annotation]]
+
* [[biomass_rxn]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
{{#set: transcription-direction=negative}}
+
* [[HISTALDEHYD-RXN]]
{{#set: right-end-position=152661}}
+
* [[RXN-8001]]
{{#set: left-end-position=139202}}
+
* [[RXN0-6978]]
{{#set: centisome-position=29.004044    }}
+
== Reaction(s) of unknown directionality ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: common-name=l-histidine}}
{{#set: nb reaction associated=1}}
+
{{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}}
 +
{{#set: molecular-weight=155.156}}

Latest revision as of 11:12, 18 March 2021

Metabolite HIS

  • common-name:
    • l-histidine
  • smiles:
    • c1(nc=nc=1cc(c(=o)[o-])[n+])
  • inchi-key:
    • hndvdqjcigzpno-yfkpbyrvsa-n
  • molecular-weight:
    • 155.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality