Difference between revisions of "HIS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06815 == * transcription-direction: ** negative * right-end-position: ** 50302 * left-end-position: ** 36386 * centisome-position: ** 48.66 ==...")
 
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06815 ==
+
== Metabolite HIS ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-histidine
−
* right-end-position:
+
* smiles:
−
** 50302
+
** c1(nc=nc=1cc(c(=o)[o-])[n+])
−
* left-end-position:
+
* inchi-key:
−
** 36386
+
** hndvdqjcigzpno-yfkpbyrvsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 48.66   
+
** 155.156
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) associated ==
+
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
−
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+
* [[HISTIDINE-DECARBOXYLASE-RXN]]
−
** Category: [[annotation]]
+
* [[biomass_rxn]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[ALANINE-AMINOTRANSFERASE-RXN]]
+
* [[HISTALDEHYD-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-8001]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-6978]]
−
* [[RXN-13698]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=l-histidine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=155.156}}
−
* [[ALANINE-SYN2-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ALANINE-DEG3-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ALACAT2-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7117]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7115]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-7383]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=50302}}
 
−
{{#set: left-end-position=36386}}
 
−
{{#set: centisome-position=48.66    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite HIS

  • common-name:
    • l-histidine
  • smiles:
    • c1(nc=nc=1cc(c(=o)[o-])[n+])
  • inchi-key:
    • hndvdqjcigzpno-yfkpbyrvsa-n
  • molecular-weight:
    • 155.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HIS&oldid=137244"