Difference between revisions of "HIS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite POLYPEPTIDE == * common-name: ** a polypeptide == Reaction(s) known to consume the compound == * 3.4.14.10-RXN * 3.4.14.5-RXN * [...")
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite POLYPEPTIDE ==
+
== Metabolite HIS ==
 
* common-name:
 
* common-name:
** a polypeptide
+
** l-histidine
 +
* smiles:
 +
** c1(nc=nc=1cc(c(=o)[o-])[n+])
 +
* inchi-key:
 +
** hndvdqjcigzpno-yfkpbyrvsa-n
 +
* molecular-weight:
 +
** 155.156
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.14.10-RXN]]
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
* [[3.4.14.5-RXN]]
+
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
* [[3.4.14.9-RXN]]
+
* [[HISTIDINE-DECARBOXYLASE-RXN]]
* [[3.4.24.56-RXN]]
+
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HISTALDEHYD-RXN]]
 +
* [[RXN-8001]]
 +
* [[RXN0-6978]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a polypeptide}}
+
{{#set: common-name=l-histidine}}
 +
{{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}}
 +
{{#set: molecular-weight=155.156}}

Latest revision as of 11:12, 18 March 2021

Metabolite HIS

  • common-name:
    • l-histidine
  • smiles:
    • c1(nc=nc=1cc(c(=o)[o-])[n+])
  • inchi-key:
    • hndvdqjcigzpno-yfkpbyrvsa-n
  • molecular-weight:
    • 155.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality