Difference between revisions of "HISTIDINAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...")
(Created page with "Category:metabolite == Metabolite HISTIDINAL == * common-name: ** histidinal * smiles: ** c1(nc=nc=1cc([ch]=o)[n+]) * inchi-key: ** vyoielonwkizjs-yfkpbyrvsa-o * molecular...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS ==
+
== Metabolite HISTIDINAL ==
 
* common-name:
 
* common-name:
** prostaglandin e2
+
** histidinal
 
* smiles:
 
* smiles:
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
+
** c1(nc=nc=1cc([ch]=o)[n+])
 
* inchi-key:
 
* inchi-key:
** xeybrnlfezdvaw-arsrfyassa-m
+
** vyoielonwkizjs-yfkpbyrvsa-o
 
* molecular-weight:
 
* molecular-weight:
** 351.462
+
** 140.164
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.141-RXN]]
+
* [[HISTALDEHYD-RXN]]
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
+
* [[HISTOLDEHYD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.141-RXN]]
+
* [[HISTOLDEHYD-RXN]]
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
 
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prostaglandin e2}}
+
{{#set: common-name=histidinal}}
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
+
{{#set: inchi-key=inchikey=vyoielonwkizjs-yfkpbyrvsa-o}}
{{#set: molecular-weight=351.462}}
+
{{#set: molecular-weight=140.164}}

Latest revision as of 11:15, 18 March 2021

Metabolite HISTIDINAL

  • common-name:
    • histidinal
  • smiles:
    • c1(nc=nc=1cc([ch]=o)[n+])
  • inchi-key:
    • vyoielonwkizjs-yfkpbyrvsa-o
  • molecular-weight:
    • 140.164

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality