Difference between revisions of "HISTIDINOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Beta-D-Galactosides == * common-name: ** a β-d-galactoside == Reaction(s) known to consume the compound == * 3.2.1.23-RXN == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(scc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Beta-D-Galactosides ==
+
== Metabolite CPD-18493 ==
 
* common-name:
 
* common-name:
** a β-d-galactoside
+
** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** nneppynerzejee-vugypbmhsa-j
 +
* molecular-weight:
 +
** 1120.05
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.23-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17114]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a β-d-galactoside}}
+
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}
 +
{{#set: molecular-weight=1120.05}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-18493

  • common-name:
    • (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nneppynerzejee-vugypbmhsa-j
  • molecular-weight:
    • 1120.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality