Difference between revisions of "HOMO-CIS-ACONITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-649 == * common-name: ** sphinganine 1-phosphate * smiles: ** cccccccccccccccc(c(cop([o-])(=o)[o-])[n+])o * inchi-key: ** yhedrjpuirm...")
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-649 ==
+
== Metabolite MESO-DIAMINOPIMELATE ==
 
* common-name:
 
* common-name:
** sphinganine 1-phosphate
+
** meso-diaminopimelate
 
* smiles:
 
* smiles:
** cccccccccccccccc(c(cop([o-])(=o)[o-])[n+])o
+
** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
 
* inchi-key:
 
* inchi-key:
** yhedrjpuirmzmp-zwkotpchsa-m
+
** gmkmezvlhjarhf-sydprgilsa-n
 
* molecular-weight:
 
* molecular-weight:
** 380.484
+
** 190.199
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SGPL11]]
+
* [[DIAMINOPIMDECARB-RXN]]
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DIAMINOPIMEPIM-RXN]]
 +
* [[RXN-14246]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SPHINGANINE-KINASE-RXN]]
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DIAMINOPIMEPIM-RXN]]
 +
* [[RXN-14246]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sphinganine 1-phosphate}}
+
{{#set: common-name=meso-diaminopimelate}}
{{#set: inchi-key=inchikey=yhedrjpuirmzmp-zwkotpchsa-m}}
+
{{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}}
{{#set: molecular-weight=380.484}}
+
{{#set: molecular-weight=190.199}}

Revision as of 11:18, 15 January 2021

Metabolite MESO-DIAMINOPIMELATE

  • common-name:
    • meso-diaminopimelate
  • smiles:
    • c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
  • inchi-key:
    • gmkmezvlhjarhf-sydprgilsa-n
  • molecular-weight:
    • 190.199

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality