Difference between revisions of "HOMO-CIS-ACONITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Red-Thioredoxin == * common-name: ** a reduced thioredoxin == Reaction(s) known to consume the compound == * 1.17.4.2-RXN * 1.8.4.1...")
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common-name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi-key: ** bjypzfuwwjsak...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Red-Thioredoxin ==
+
== Metabolite HOMO-CIS-ACONITATE ==
 
* common-name:
 
* common-name:
** a reduced thioredoxin
+
** cis-homoaconitate
 +
* smiles:
 +
** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
 +
* inchi-key:
 +
** bjypzfuwwjsakc-arjawskdsa-k
 +
* molecular-weight:
 +
** 185.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.17.4.2-RXN]]
+
* [[HOMOACONITATE-HYDRATASE-RXN]]
* [[1.8.4.12-RXN]]
 
* [[1.8.4.14-RXN]]
 
* [[1.8.4.8-RXN]]
 
* [[ADPREDUCT-RXN]]
 
* [[CDPREDUCT-RXN]]
 
* [[DAOTO]]
 
* [[DCDT]]
 
* [[DGOTO]]
 
* [[DUDT]]
 
* [[GDPREDUCT-RXN]]
 
* [[MERCAPYSTRANS-RXN]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 
* [[RXN-12019]]
 
* [[RXN-8668]]
 
* [[RXN0-267]]
 
* [[RXN0-5468]]
 
* [[UDPREDUCT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.8.4.12-RXN]]
+
* [[HOMOACONITATE-HYDRATASE-RXN]]
* [[1.8.4.8-RXN]]
 
* [[TDSR]]
 
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced thioredoxin}}
+
{{#set: common-name=cis-homoaconitate}}
 +
{{#set: inchi-key=inchikey=bjypzfuwwjsakc-arjawskdsa-k}}
 +
{{#set: molecular-weight=185.113}}

Latest revision as of 11:16, 18 March 2021

Metabolite HOMO-CIS-ACONITATE

  • common-name:
    • cis-homoaconitate
  • smiles:
    • c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
  • inchi-key:
    • bjypzfuwwjsakc-arjawskdsa-k
  • molecular-weight:
    • 185.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality