Difference between revisions of "HOMO-CIS-ACONITATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYLMALEATE == * common-name: ** citraconate * smiles: ** cc(=cc(=o)[o-])c(=o)[o-] * inchi-key: ** hnegqiomvppmnr-ihwypqmzsa-l * mole...") |
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common-name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi-key: ** bjypzfuwwjsak...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HOMO-CIS-ACONITATE == |
* common-name: | * common-name: | ||
− | ** | + | ** cis-homoaconitate |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bjypzfuwwjsakc-arjawskdsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 185.113 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cis-homoaconitate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bjypzfuwwjsakc-arjawskdsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=185.113}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite HOMO-CIS-ACONITATE
- common-name:
- cis-homoaconitate
- smiles:
- c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
- inchi-key:
- bjypzfuwwjsakc-arjawskdsa-k
- molecular-weight:
- 185.113