|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTATHIONINE-BETA-SYNTHASE-RXN CYSTATHIONINE-BETA-SYNTHASE-RXN] == | + | == Metabolite HOMO-CIS-ACONITATE == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** cystathionine β-synthase | + | ** cis-homoaconitate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.2.1.22 ec-4.2.1.22] | + | ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[HOMO-CYS]][c] '''+''' 1 [[SER]][c] '''<=>''' 1 [[L-CYSTATHIONINE]][c] '''+''' 1 [[WATER]][c]
| + | ** bjypzfuwwjsakc-arjawskdsa-k |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ15937]]
| + | ** 185.113 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
| − | * Gene: [[SJ20026]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=cis-homoaconitate}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=bjypzfuwwjsakc-arjawskdsa-k}} |
| − | * Gene: [[SJ15938]]
| + | {{#set: molecular-weight=185.113}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[HOMOCYSDEGR-PWY]], L-cysteine biosynthesis III (from L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] | |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-I9]], L-cysteine biosynthesis VI (from L-methionine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-I9 PWY-I9]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[PWY-801]], homocysteine and cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10115 10115]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01290 R01290]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P32232 P32232]
| |
| − | ** [http://www.uniprot.org/uniprot/P32582 P32582]
| |
| − | ** [http://www.uniprot.org/uniprot/P35520 P35520]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9YCN5 Q9YCN5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q12633 Q12633]
| |
| − | ** [http://www.uniprot.org/uniprot/P72662 P72662]
| |
| − | ** [http://www.uniprot.org/uniprot/O59701 O59701]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=cystathionine β-synthase}} | |
| − | {{#set: ec-number=ec-4.2.1.22}} | |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
