|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.46-RXN 2.4.1.46-RXN] == | + | == Metabolite HOMO-CIT == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 1,2-diacylglycerol 3-beta-galactosyltransferase | + | ** (2r)-homocitrate |
| − | ** monogalactosyldiacylglycerol synthase | + | * smiles: |
| − | * ec-number:
| + | ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o |
| − | ** [http://enzyme.expasy.org/EC/2.4.1.46 ec-2.4.1.46] | + | * inchi-key: |
| − | == Reaction formula == | + | ** xkjvevrqmlksmo-ssdottswsa-k |
| − | * 1 [[CPD-14553]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[D-Galactosyl-12-diacyl-glycerols]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 203.128 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ11730]] | + | * [[RXN-13722]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN-13722]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=(2r)-homocitrate}} |
| − | * Gene: [[SJ01255]]
| + | {{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=203.128}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ14527]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ02446]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-401]], galactolipid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] | |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14946 14946]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02691 R02691]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/O81770 O81770]
| |
| − | ** [http://www.uniprot.org/uniprot/P93115 P93115]
| |
| − | ** [http://www.uniprot.org/uniprot/O82730 O82730]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=monogalactosyldiacylglycerol synthase|1,2-diacylglycerol 3-beta-galactosyltransferase}} | |
| − | {{#set: ec-number=ec-2.4.1.46}} | |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
| |
