Difference between revisions of "HOMO-CIT"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-557 == * common-name: ** a protein-nω-(adp-d-ribosyl)-l-arginine == Reaction(s) known to consume the compound == * 2.4.2.31-R...") |
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HOMO-CIT == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r)-homocitrate |
| + | * smiles: | ||
| + | ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o | ||
| + | * inchi-key: | ||
| + | ** xkjvevrqmlksmo-ssdottswsa-k | ||
| + | * molecular-weight: | ||
| + | ** 203.128 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13722]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13722]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r)-homocitrate}} |
| + | {{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}} | ||
| + | {{#set: molecular-weight=203.128}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite HOMO-CIT
- common-name:
- (2r)-homocitrate
- smiles:
- c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
- inchi-key:
- xkjvevrqmlksmo-ssdottswsa-k
- molecular-weight:
- 203.128
