Difference between revisions of "HOMO-CIT"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17919 RXN-17919] == * direction: ** left-to-right * common-name: ** dna ligase (atp) == Reactio...") |
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite HOMO-CIT == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (2r)-homocitrate |
− | + | * smiles: | |
− | * | + | ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o |
− | + | * inchi-key: | |
− | * | + | ** xkjvevrqmlksmo-ssdottswsa-k |
− | + | * molecular-weight: | |
− | ** | + | ** 203.128 |
− | * | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13722]] | |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13722]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(2r)-homocitrate}} | |
− | + | {{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}} | |
− | + | {{#set: molecular-weight=203.128}} | |
− | |||
− | == | ||
− | |||
− | * | ||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite HOMO-CIT
- common-name:
- (2r)-homocitrate
- smiles:
- c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
- inchi-key:
- xkjvevrqmlksmo-ssdottswsa-k
- molecular-weight:
- 203.128