Difference between revisions of "HOMO-CIT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17919 RXN-17919] == * direction: ** left-to-right * common-name: ** dna ligase (atp) == Reactio...")
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17919 RXN-17919] ==
+
== Metabolite HOMO-CIT ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dna ligase (atp)
+
** (2r)-homocitrate
−
== Reaction formula ==
+
* smiles:
−
* 1 [[3-Hydroxy-Terminated-DNAs]][c] '''+''' 1 [[A-5-prime-PP-5-prime-DNA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[DNA-N]][c] '''+''' 1 [[PROTON]][c]
+
** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ15543]]
+
** xkjvevrqmlksmo-ssdottswsa-k
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 203.128
−
* Gene: [[SJ13521]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13722]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ19344]]
+
* [[RXN-13722]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=(2r)-homocitrate}}
−
* Gene: [[SJ16080]]
+
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=203.128}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dna ligase (atp)}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite HOMO-CIT

  • common-name:
    • (2r)-homocitrate
  • smiles:
    • c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
  • inchi-key:
    • xkjvevrqmlksmo-ssdottswsa-k
  • molecular-weight:
    • 203.128

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HOMO-CIT&oldid=138791"