Difference between revisions of "HOMO-CYS"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite DCTP ==
+== Metabolite HOMO-CYS ==
 * common-name:
-** dctp
+** l-homocysteine
 * smiles:
-** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+** c(c(ccs)[n+])(=o)[o-]
 * inchi-key:
-** rgwhqcvhvjxokc-shyzeuofsa-j
+** fffhzydwpbmwhy-vkhmyheasa-n
 * molecular-weight:
-** 463.127
+** 135.181
 == Reaction(s) known to consume the compound ==
-* [[DCTCP]]
+* [[2.1.1.5-RXN]]
-* [[DCTP-PYROPHOSPHATASE-RXN]]
+* [[ACETYLHOMOSER-CYS-RXN]]
-* [[DCTPtm]]
+* [[ADENOSYLHOMOCYSTEINASE-RXN]]
-* [[DCTUP]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
-* [[RXN-14198]]
+* [[HOMOCYSMET-RXN]]
-* [[RXN-14216]]
+* [[HOMOCYSMETB12-RXN]]
+* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
+* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
+* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
+* [[MMUM-RXN]]
+* [[RXN-15148]]
+* [[RXN-9384]]
 == Reaction(s) known to produce the compound ==
-* [[ATDCD]]
+* [[ACETYLHOMOSER-CYS-RXN]]
-* [[ATDCDm]]
+* [[ADENOSYLHOMOCYSTEINASE-RXN]]
-* [[DCDPKIN-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
-* [[DCTPtm]]
+* [[HOMOCYSMET-RXN]]
-* [[RXN0-723]]
+* [[RXN-9384]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dctp}}
+{{#set: common-name=l-homocysteine}}
-{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
+{{#set: inchi-key=inchikey=fffhzydwpbmwhy-vkhmyheasa-n}}
-{{#set: molecular-weight=463.127}}
+{{#set: molecular-weight=135.181}}