Difference between revisions of "HOMO-SER"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-UREIDO-ISOBUTYRATE == * common-name: ** 3-(carbamoylamino)-2-methylpropanoate * smiles: ** cc(cnc(n)=o)c(=o)[o-] * inchi-key: ** phentz...") |
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-hexaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-hexaprenyl diphosphate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ngfsmhkftzrokj-mmszmyibsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 583.66 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9003]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-hexaprenyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=583.66}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-hexaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ngfsmhkftzrokj-mmszmyibsa-k
- molecular-weight:
- 583.66
