Difference between revisions of "HOMO-SER"

Latest revision as of 11:14, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ==
+== Metabolite HOMO-SER ==
 * common-name:
-** all-trans-hexaprenyl diphosphate
+** l-homoserine
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+** c(co)c([n+])c([o-])=o
 * inchi-key:
-** ngfsmhkftzrokj-mmszmyibsa-k
+** ukauyvftdyckqa-vkhmyheasa-n
 * molecular-weight:
-** 583.66
+** 119.12
 == Reaction(s) known to consume the compound ==
-* [[RXN-9003]]
+* [[CYSTATHIONASE-RXN]]
+* [[HOMOSERDEAM-RXN]]
+* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
+* [[HOMOSERKIN-RXN]]
+* [[HOMSUCTRAN-RXN]]
+* [[RXN-14049]]
 == Reaction(s) known to produce the compound ==
+* [[CYSTATHIONASE-RXN]]
+* [[HOMOSERDEHYDROG-RXN]]
+* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=all-trans-hexaprenyl diphosphate}}
+{{#set: common-name=l-homoserine}}
-{{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}}
+{{#set: inchi-key=inchikey=ukauyvftdyckqa-vkhmyheasa-n}}
-{{#set: molecular-weight=583.66}}
+{{#set: molecular-weight=119.12}}