Difference between revisions of "HOMO-SER"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
(Created page with "Category:metabolite == Metabolite HOMO-SER == * common-name: ** l-homoserine * smiles: ** c(co)c([n+])c([o-])=o * inchi-key: ** ukauyvftdyckqa-vkhmyheasa-n * molecular-wei...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HOMO-SER == |
* common-name: | * common-name: | ||
− | ** | + | ** l-homoserine |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(co)c([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ukauyvftdyckqa-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 119.12 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[CYSTATHIONASE-RXN]] |
− | * [[ | + | * [[HOMOSERDEAM-RXN]] |
+ | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
+ | * [[HOMOSERKIN-RXN]] | ||
+ | * [[HOMSUCTRAN-RXN]] | ||
+ | * [[RXN-14049]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[CYSTATHIONASE-RXN]] |
+ | * [[HOMOSERDEHYDROG-RXN]] | ||
+ | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-homoserine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ukauyvftdyckqa-vkhmyheasa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=119.12}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite HOMO-SER
- common-name:
- l-homoserine
- smiles:
- c(co)c([n+])c([o-])=o
- inchi-key:
- ukauyvftdyckqa-vkhmyheasa-n
- molecular-weight:
- 119.12
Reaction(s) known to consume the compound
- CYSTATHIONASE-RXN
- HOMOSERDEAM-RXN
- HOMOSERINE-O-ACETYLTRANSFERASE-RXN
- HOMOSERKIN-RXN
- HOMSUCTRAN-RXN
- RXN-14049