Difference between revisions of "HOMOCYSDEGR-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] ==
+== Pathway HOMOCYSDEGR-PWY ==
+* taxonomic-range:
+** tax-33154
+** tax-2157
+** tax-2
 * common-name:
-** (s)-5-hydroxyisourate
+** l-cysteine biosynthesis iii (from l-homocysteine)
-* smiles:
+== Reaction(s) found ==
-** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
-* inchi-key:
+* [[RXN-14048]]
-** ltqypavlayvktk-yfkpbyrvsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-15130 RXN-15130]
-** 184.111
+{{#set: taxonomic-range=tax-33154|tax-2|tax-2157}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-cysteine biosynthesis iii (from l-homocysteine)}}
-* [[3.5.2.17-RXN]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=1.0}}
-* [[URATE-OXIDASE-RXN]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-5-hydroxyisourate}}
-{{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}}
-{{#set: molecular-weight=184.111}}