Difference between revisions of "HOMOCYSDEGR-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * common-name: ** (s)-5-hydroxyisourate * smiles: ** c2...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * common-name: ** ergosta-5,7,24(28)-trien-3β-ol * smiles: ** cc(c)c(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
 
* common-name:
 
* common-name:
** (s)-5-hydroxyisourate
+
** ergosta-5,7,24(28)-trien-3β-ol
 
* smiles:
 
* smiles:
** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** ltqypavlayvktk-yfkpbyrvsa-n
+
** zepnvcgpjxyabb-loioqlkmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 184.111
+
** 396.655
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.2.17-RXN]]
+
* [[RXN-707]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[URATE-OXIDASE-RXN]]
+
* [[RXN3O-218]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-5-hydroxyisourate}}
+
{{#set: common-name=ergosta-5,7,24(28)-trien-3β-ol}}
{{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}}
+
{{#set: inchi-key=inchikey=zepnvcgpjxyabb-loioqlkmsa-n}}
{{#set: molecular-weight=184.111}}
+
{{#set: molecular-weight=396.655}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-700

  • common-name:
    • ergosta-5,7,24(28)-trien-3β-ol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • zepnvcgpjxyabb-loioqlkmsa-n
  • molecular-weight:
    • 396.655

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality