Difference between revisions of "HOMOGENTISATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17411 == * transcription-direction: ** positive * right-end-position: ** 151789 * left-end-position: ** 144911 * centisome-position: ** 55.11433...")
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17411 ==
+
== Metabolite HOMOGENTISATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** homogentisate
−
* right-end-position:
+
* smiles:
−
** 151789
+
** c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
−
* left-end-position:
+
* inchi-key:
−
** 144911
+
** igmnyecmumzddf-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 55.11433   
+
** 167.141
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14929]]
−
== Reaction(s) associated ==
+
* [[RXN-2541]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-2761]]
−
* [[5.3.4.1-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HPPD]]
−
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=homogentisate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}}
−
* [[DISULISOM-RXN]]
+
{{#set: molecular-weight=167.141}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-15684]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[THIOL-OXIDASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6797]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6147]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7533]]
 
−
** '''3''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=151789}}
 
−
{{#set: left-end-position=144911}}
 
−
{{#set: centisome-position=55.11433    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite HOMOGENTISATE

  • common-name:
    • homogentisate
  • smiles:
    • c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
  • inchi-key:
    • igmnyecmumzddf-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HOMOGENTISATE&oldid=137929"