Difference between revisions of "HOMOGENTISATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PLASMENYLCHOLINE == * common-name: ** a plasmenylcholine == Reaction(s) known to consume the compound == * PLASMALOGEN-SYNTHASE-RXN *...") |
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HOMOGENTISATE == |
* common-name: | * common-name: | ||
− | ** | + | ** homogentisate |
+ | * smiles: | ||
+ | ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) | ||
+ | * inchi-key: | ||
+ | ** igmnyecmumzddf-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 167.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14929]] |
− | * [[RXN- | + | * [[RXN-2541]] |
+ | * [[RXN-2761]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] |
+ | * [[HPPD]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=homogentisate}} |
+ | {{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=167.141}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite HOMOGENTISATE
- common-name:
- homogentisate
- smiles:
- c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
- inchi-key:
- igmnyecmumzddf-uhfffaoysa-m
- molecular-weight:
- 167.141