Difference between revisions of "HOMOGENTISATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine13 == * common-name: ** a pseudouridine13 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-pseudouridine13 ==
+
== Metabolite HOMOGENTISATE ==
 
* common-name:
 
* common-name:
** a pseudouridine13 in trna
+
** homogentisate
 +
* smiles:
 +
** c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
 +
* inchi-key:
 +
** igmnyecmumzddf-uhfffaoysa-m
 +
* molecular-weight:
 +
** 167.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14929]]
 +
* [[RXN-2541]]
 +
* [[RXN-2761]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11841]]
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 +
* [[HPPD]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine13 in trna}}
+
{{#set: common-name=homogentisate}}
 +
{{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}}
 +
{{#set: molecular-weight=167.141}}

Latest revision as of 11:13, 18 March 2021

Metabolite HOMOGENTISATE

  • common-name:
    • homogentisate
  • smiles:
    • c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
  • inchi-key:
    • igmnyecmumzddf-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality