Difference between revisions of "HOMOGENTISATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17527 == * transcription-direction: ** positive * right-end-position: ** 260493 * left-end-position: ** 248162 * centisome-position: ** 95.22022...") |
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite HOMOGENTISATE == |
| − | * | + | * common-name: |
| − | ** | + | ** homogentisate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** igmnyecmumzddf-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 167.141 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14929]] |
| − | == Reaction(s) | + | * [[RXN-2541]] |
| − | * [[ | + | * [[RXN-2761]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] | |
| − | {{#set: | + | * [[HPPD]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=homogentisate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}} |
| − | + | {{#set: molecular-weight=167.141}} | |
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite HOMOGENTISATE
- common-name:
- homogentisate
- smiles:
- c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
- inchi-key:
- igmnyecmumzddf-uhfffaoysa-m
- molecular-weight:
- 167.141
