Difference between revisions of "HOMOSER-THRESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-OH-4-ACETYL-2-OXOGLUTARATE 4-OH-4-ACETYL-2-OXOGLUTARATE] == * common-name: ** 2-hydroxy-4-oxo...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Butanoyl-ACPs Butanoyl-ACPs] == * common-name: ** a butanoyl-[acp] == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-OH-4-ACETYL-2-OXOGLUTARATE 4-OH-4-ACETYL-2-OXOGLUTARATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Butanoyl-ACPs Butanoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
+
** a butanoyl-[acp]
* smiles:
 
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
 
* inchi-key:
 
** rqmcndrmpzbeod-uhfffaoysa-k
 
* molecular-weight:
 
** 217.112
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2464]]
+
* [[RXN-9516]]
 +
* [[RXN-9648]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2464]]
+
* [[RXN-9515]]
 +
* [[RXN-9657]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
+
{{#set: common-name=a butanoyl-[acp]}}
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
 
{{#set: molecular-weight=217.112}}
 

Revision as of 09:22, 27 August 2019

Metabolite Butanoyl-ACPs

  • common-name:
    • a butanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a butanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.