Difference between revisions of "HS"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
+== Metabolite HS ==
 * common-name:
-** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
+** hydrogen sulfide
 * smiles:
-** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
+** [sh2]
 * inchi-key:
-** rqmcndrmpzbeod-uhfffaoysa-k
+** rwsotubldixvet-uhfffaoysa-n
 * molecular-weight:
-** 217.112
+** 34.076
 == Reaction(s) known to consume the compound ==
-* [[RXN-2464]]
+* [[ACETYLHOMOSER-CYS-RXN]]
+* [[ACSERLY-RXN]]
+* [[RXN-9384]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-2464]]
+* [[ACETYLHOMOSER-CYS-RXN]]
+* [[ACSERLY-RXN]]
+* [[DCYSDESULF-RXN]]
+* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
+* [[LCYSDESULF-RXN]]
+* [[MERCAPYSTRANS-RXN]]
+* [[RXN-15129]]
+* [[RXN-15148]]
+* [[RXN-9384]]
+* [[SULFITE-REDUCT-RXN]]
+* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
+{{#set: common-name=hydrogen sulfide}}
-{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
+{{#set: inchi-key=inchikey=rwsotubldixvet-uhfffaoysa-n}}
-{{#set: molecular-weight=217.112}}
+{{#set: molecular-weight=34.076}}