Difference between revisions of "HS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHHB-METHYLTRANSFER-RXN DHHB-METHYLTRANSFER-RXN] == * direction: ** left-to-right * common-name: **...")
(Created page with "Category:metabolite == Metabolite CPD-157 == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles: ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o * inchi-k...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHHB-METHYLTRANSFER-RXN DHHB-METHYLTRANSFER-RXN] ==
+
== Metabolite CPD-157 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 3-demethylubiquinone-8 3-o-methyltransferase
+
** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.64 ec-2.1.1.64]
+
** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
* synonymous:
+
* inchi-key:
** 5-demethylubiquinone-8 methyltransferase
+
** rfenovfrmprrji-ydcwotkksa-l
== Reaction formula ==
+
* molecular-weight:
* 1 [[OCTAPRENYL-METHYL-OH-METHOXY-BENZQ]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-9956]][c] '''+''' 1 [[PROTON]][c]
+
** 212.159
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ16864]]
+
* [[MHPCHYDROL-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ13007]]
+
{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=212.159}}
** Category: [[orthology]]
 
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY-6708]], ubiquinol-8 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6708 PWY-6708]
 
** '''5''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-5870]], ubiquinol-8 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870]
 
** '''4''' reactions found over '''9''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28680 28680]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P17993 P17993]
 
** [http://www.uniprot.org/uniprot/Q9JWE6 Q9JWE6]
 
** [http://www.uniprot.org/uniprot/Q9ZCT9 Q9ZCT9]
 
** [http://www.uniprot.org/uniprot/P37431 P37431]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=3-demethylubiquinone-8 3-o-methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.64}}
 
{{#set: synonymous=5-demethylubiquinone-8 methyltransferase}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-157

  • common-name:
    • (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
  • smiles:
    • c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • rfenovfrmprrji-ydcwotkksa-l
  • molecular-weight:
    • 212.159

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality