Difference between revisions of "HS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-157 == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles: ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rqmcndrmpzbeod-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 217.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-2464]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-2464]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.112}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE
- common-name:
- 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
- smiles:
- c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
- inchi-key:
- rqmcndrmpzbeod-uhfffaoysa-k
- molecular-weight:
- 217.112