Difference between revisions of "HS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite Mannosyl5-N-acetyl-glucosamine2-R == * common-name: ** man5glcnac3-[protein] == Reaction(s) known to consume the compound == == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
+
== Metabolite Mannosyl5-N-acetyl-glucosamine2-R ==
 
* common-name:
 
* common-name:
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
+
** man5glcnac3-[protein]
* smiles:
 
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
 
* inchi-key:
 
** rqmcndrmpzbeod-uhfffaoysa-k
 
* molecular-weight:
 
** 217.112
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2464]]
+
* [[2.4.1.101-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
+
{{#set: common-name=man5glcnac3-[protein]}}
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
 
{{#set: molecular-weight=217.112}}
 

Revision as of 13:12, 14 January 2021

Metabolite Mannosyl5-N-acetyl-glucosamine2-R

  • common-name:
    • man5glcnac3-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "man5glcnac3-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.