Difference between revisions of "HYDROGEN-PEROXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...") |
(Created page with "Category:metabolite == Metabolite CPD-535 == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-535 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fructose 2,6-bisphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yxwoajxnvlxpmu-zxxmmsqzsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.1.3.46-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fructose 2,6-bisphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-535
- common-name:
- β-d-fructose 2,6-bisphosphate
- smiles:
- c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-]
- inchi-key:
- yxwoajxnvlxpmu-zxxmmsqzsa-j
- molecular-weight:
- 336.085
