Difference between revisions of "HYDROGEN-PEROXIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-535 == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] * inc...")
(Created page with "Category:metabolite == Metabolite HYDROGEN-PEROXIDE == * common-name: ** hydrogen peroxide * smiles: ** oo * inchi-key: ** mhajpdpjqmaiiy-uhfffaoysa-n * molecular-weight:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-535 ==
+
== Metabolite HYDROGEN-PEROXIDE ==
 
* common-name:
 
* common-name:
** β-d-fructose 2,6-bisphosphate
+
** hydrogen peroxide
 
* smiles:
 
* smiles:
** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-]
+
** oo
 
* inchi-key:
 
* inchi-key:
** yxwoajxnvlxpmu-zxxmmsqzsa-j
+
** mhajpdpjqmaiiy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 34.015
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.46-RXN]]
+
* [[CATAL-RXN]]
 +
* [[CYTOCHROME-C-PEROXIDASE-RXN]]
 +
* [[FATTY-ACID-PEROXIDASE-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GTHP]]
 +
* [[PEROXID-RXN]]
 +
* [[RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.]]
 +
* [[RXN-12440]]
 +
* [[RXN-14189]]
 +
* [[RXN-14240]]
 +
* [[RXN-15288]]
 +
* [[RXN-17352]]
 +
* [[RXN-3521]]
 +
* [[RXN-8635]]
 +
* [[RXN0-267]]
 +
* [[RXN66-1]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.3.37-RXN]]
 +
* [[1.1.3.41-RXN]]
 +
* [[1.2.3.14-RXN]]
 +
* [[1.3.3.12-RXN]]
 +
* [[1.4.3.19-RXN]]
 +
* [[1.8.3.5-RXN]]
 +
* [[ACYL-COA-OXIDASE-RXN]]
 +
* [[ARG-OXIDATION-RXN]]
 +
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
 +
* [[GLYOXYLATE-OXIDASE-RXN]]
 +
* [[HDAO10x]]
 +
* [[L-AMINO-ACID-OXIDASE-RXN]]
 +
* [[L-ASPARTATE-OXID-RXN]]
 +
* [[L-GULONOLACTONE-OXIDASE-RXN]]
 +
* [[PMPOXI-RXN]]
 +
* [[PNPOXI-RXN]]
 +
* [[PPPGO]]
 +
* [[PROTOPORGENOXI-RXN]]
 +
* [[PYRIDOXINE-4-OXIDASE-RXN]]
 +
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 +
* [[RXN-1]]
 +
* [[RXN-10696]]
 +
* [[RXN-10706]]
 +
* [[RXN-10707]]
 +
* [[RXN-10745]]
 +
* [[RXN-10778]]
 +
* [[RXN-10817]]
 +
* [[RXN-10907]]
 +
* [[RXN-10908]]
 +
* [[RXN-10910]]
 +
* [[RXN-10913]]
 +
* [[RXN-11026]]
 +
* [[RXN-11026-PALMITYL-COA/OXYGEN-MOLECULE//CPD0-2117/HYDROGEN-PEROXIDE.58.]]
 +
* [[RXN-11067]]
 +
* [[RXN-11519]]
 +
* [[RXN-11520]]
 +
* [[RXN-11521]]
 +
* [[RXN-11623]]
 +
* [[RXN-12518]]
 +
* [[RXN-12614]]
 +
* [[RXN-12669]]
 +
* [[RXN-13689]]
 +
* [[RXN-1401]]
 +
* [[RXN-14576]]
 +
* [[RXN-14771]]
 +
* [[RXN-14775]]
 +
* [[RXN-14785]]
 +
* [[RXN-14789]]
 +
* [[RXN-14796]]
 +
* [[RXN-15684]]
 +
* [[RXN-16134]]
 +
* [[RXN-17113]]
 +
* [[RXN-17130]]
 +
* [[RXN-17517]]
 +
* [[RXN-17951]]
 +
* [[RXN-4444]]
 +
* [[RXN-5821]]
 +
* [[RXN-8672]]
 +
* [[RXN-8673]]
 +
* [[RXN-8674]]
 +
* [[RXN-9598]]
 +
* [[RXN-969]]
 +
* [[RXN-9926]]
 +
* [[RXN6666-4]]
 +
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 +
* [[SULFITE-OXIDASE-RXN]]
 +
* [[SUPEROX-DISMUT-RXN]]
 +
* [[THIOL-OXIDASE-RXN]]
 +
* [[URATE-OXIDASE-RXN]]
 +
* [[XANTHINE-OXIDASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=&beta;-d-fructose 2,6-bisphosphate}}
+
{{#set: common-name=hydrogen peroxide}}
{{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}}
+
{{#set: inchi-key=inchikey=mhajpdpjqmaiiy-uhfffaoysa-n}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=34.015}}

Latest revision as of 11:11, 18 March 2021

Metabolite HYDROGEN-PEROXIDE

  • common-name:
    • hydrogen peroxide
  • smiles:
    • oo
  • inchi-key:
    • mhajpdpjqmaiiy-uhfffaoysa-n
  • molecular-weight:
    • 34.015

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality