Difference between revisions of "HYDROGEN-PEROXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11879 == * common-name: ** 3,4-dihydroxymandelate * smiles: ** c(=o)([o-])c(c1(=cc=c(o)c(o)=c1))o * inchi-key: ** rghmisiykihajw-ssdo...") |
(Created page with "Category:metabolite == Metabolite ZN+2 == * common-name: ** zn2+ * smiles: ** [zn++] * inchi-key: ** ptfcdoflopiggs-uhfffaoysa-n * molecular-weight: ** 65.38 == Reaction(s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ZN+2 == |
* common-name: | * common-name: | ||
− | ** | + | ** zn2+ |
* smiles: | * smiles: | ||
− | ** | + | ** [zn++] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ptfcdoflopiggs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 65.38 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ExchangeSeed-ZN+2]] | ||
+ | * [[TransportSeed-ZN+2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ExchangeSeed-ZN+2]] |
+ | * [[TransportSeed-ZN+2]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=zn2+}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ptfcdoflopiggs-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=65.38}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite ZN+2
- common-name:
- zn2+
- smiles:
- [zn++]
- inchi-key:
- ptfcdoflopiggs-uhfffaoysa-n
- molecular-weight:
- 65.38